CAS 13615-36-6
:N-(2-Methyl-4-nitro-1-naphthalenyl)acetamide
Description:
N-(2-Methyl-4-nitro-1-naphthalenyl)acetamide, with the CAS number 13615-36-6, is an organic compound characterized by its naphthalene structure substituted with a nitro group and an acetamide functional group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the naphthalene ring. The nitro group contributes to its electron-withdrawing characteristics, which can influence its reactivity and solubility in various solvents. The acetamide moiety provides potential for hydrogen bonding, affecting its physical properties such as melting point and solubility in polar solvents. This compound may be utilized in various chemical syntheses and research applications, particularly in the fields of organic chemistry and materials science. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes be sensitive and require careful management to avoid hazards.
Formula:C13H12N2O3
InChI:InChI=1S/C13H12N2O3/c1-8-7-12(15(17)18)10-5-3-4-6-11(10)13(8)14-9(2)16/h3-7H,1-2H3,(H,14,16)
InChI key:InChIKey=CHVQNZWUGKWRHP-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C2=C(C(N(=O)=O)=CC1C)C=CC=C2
Synonyms:- NSC 28609
- N-(2-Methyl-4-nitro-1-naphthalenyl)acetamide
- Acetamide, N-(2-methyl-4-nitro-1-naphthyl)-
- Acetamide, N-(2-methyl-4-nitro-1-naphthalenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
