
CAS 13615-41-3
:Indole-3-glycerol
Description:
Indole-3-glycerol, with the CAS number 13615-41-3, is a chemical compound that belongs to the class of indole derivatives. It is characterized by the presence of an indole ring, which is a bicyclic structure composed of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound is typically involved in various biochemical processes, particularly in plant physiology, where it plays a role in the biosynthesis of auxins, which are essential plant hormones that regulate growth and development. Indole-3-glycerol is soluble in polar solvents, and its structure allows for interactions with biological macromolecules, influencing metabolic pathways. Additionally, it may exhibit antioxidant properties and has been studied for its potential applications in agriculture and medicine. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it an interesting subject for further research in both synthetic and natural contexts.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c13-6-10(14)11(15)8-5-12-9-4-2-1-3-7(8)9/h1-5,10-15H,6H2
InChI key:InChIKey=XINKZRRAVQNCLX-UHFFFAOYSA-N
SMILES:C(C(CO)O)(O)C=1C=2C(NC1)=CC=CC2
Synonyms:- 1,2,3-Propanetriol, 1-indol-3-yl-
- Indole-3-glycerol
- Indoleglycerol
- 1-(1H-Indol-3-yl)-1,2,3-propanetriol
- 1,2,3-Propanetriol, 1-(1H-indol-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
