CAS 13616-34-7
:(E)-3-(Dimethylamino)-2-methoxyacrylaldehyde
Description:
(E)-3-(Dimethylamino)-2-methoxyacrylaldehyde, with the CAS number 13616-34-7, is an organic compound characterized by its functional groups and structural features. It contains an aldehyde group, which is indicative of its reactivity and potential for undergoing oxidation or condensation reactions. The presence of a dimethylamino group suggests that it may exhibit basic properties and can participate in nucleophilic reactions. The methoxy group contributes to its overall polarity and can influence its solubility in various solvents. This compound is typically a colorless to pale yellow liquid and may have a distinctive odor. Its structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the (E) configuration indicates the specific geometric arrangement of substituents around the double bond, which can significantly affect its chemical behavior and interactions. As with many organic compounds, safety precautions should be taken when handling this substance due to its potential reactivity and toxicity.
Formula:C6H11NO2
InChI:InChI=1/C6H11NO2/c1-7(2)4-6(5-8)9-3/h4-5H,1-3H3/b6-4+
Synonyms:- (2E)-3-(Dimethylamino)-2-methoxyacrylaldehyde
- 2-propenal, 3-(dimethylamino)-2-methoxy-, (2E)-
- (2E)-3-(dimethylamino)-2-methoxyprop-2-enal
- 2-Propenal,3-(dimethylamino)-2-methoxy-
- (E)-3-(Dimethylamino)-2-methoxyacrylaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
