CAS 13616-84-7
:Sulfide, 2,4-dinitrophenyl 2,4-xylyl
Description:
Sulfide, 2,4-dinitrophenyl 2,4-xylyl, with the CAS number 13616-84-7, is an organic compound characterized by the presence of a sulfide functional group, which consists of a sulfur atom bonded to two organic groups. This compound features a dinitrophenyl moiety, indicating the presence of two nitro groups (-NO2) attached to a phenyl ring, which contributes to its reactivity and potential applications in various chemical processes. The 2,4-xylyl group, derived from xylenes, adds to the compound's structural complexity and hydrophobic characteristics. Generally, compounds like this may exhibit properties such as moderate solubility in organic solvents, potential toxicity, and reactivity towards nucleophiles due to the electron-withdrawing nature of the nitro groups. They may also be used in synthetic organic chemistry, particularly in the development of dyes, pesticides, or as intermediates in the synthesis of more complex molecules. Safety precautions should be taken when handling such compounds due to their potential hazards.
Formula:C14H12N2O4S
InChI:InChI=1S/C14H12N2O4S/c1-9-3-5-13(10(2)7-9)21-14-6-4-11(15(17)18)8-12(14)16(19)20/h3-8H,1-2H3
InChI key:InChIKey=DEKAJGGPWMWATF-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(SC2=C(C)C=C(C)C=C2)C=CC(N(=O)=O)=C1
Synonyms:- Sulfide, 2,4-dinitrophenyl 2,4-xylyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
