CAS 13617-28-2
:[2-(Dichloromethylsilyl)-1-methylethyl]benzene
Description:
[2-(Dichloromethylsilyl)-1-methylethyl]benzene, with the CAS number 13617-28-2, is an organosilicon compound characterized by the presence of a dichloromethylsilyl group attached to a benzene ring. This compound typically exhibits properties common to both aromatic hydrocarbons and organosilicon compounds. It is likely to be a colorless to pale yellow liquid with a distinctive odor, reflecting its aromatic nature. The dichloromethylsilyl group introduces reactivity, particularly in nucleophilic substitution reactions, making it useful in various chemical syntheses and applications. The presence of chlorine atoms enhances its potential for further chemical modifications. Additionally, the compound may exhibit moderate volatility and solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. Safety considerations are important, as the chlorine content can pose health risks, necessitating proper handling and storage protocols. Overall, this compound serves as a valuable intermediate in the synthesis of more complex organosilicon materials and functionalized aromatic compounds.
Formula:C10H14Cl2Si
InChI:InChI=1S/C10H14Cl2Si/c1-9(8-13(2,11)12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3
InChI key:InChIKey=OVUWGCLZOZCJBA-UHFFFAOYSA-N
SMILES:C(C[Si](C)(Cl)Cl)(C)C1=CC=CC=C1
Synonyms:- (2-Phenylpropyl)methyldichlorosilane
- Benzene, [2-(dichloromethylsilyl)-1-methylethyl]-
- Dichloro(Methyl)(2-Phenylpropyl)Silane
- Silane, dichloromethyl(2-phenylpropyl)-
- Silane, dichloromethyl(β-methylphenethyl)-
- [2-(Dichloromethylsilyl)-1-methylethyl]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.