CymitQuimica logo

CAS 13617-40-8

:

Silane, trichloro(3-phenylpropyl)-

Description:
Silane, trichloro(3-phenylpropyl)-, with the CAS number 13617-40-8, is an organosilicon compound characterized by the presence of a silane group bonded to three chlorine atoms and a 3-phenylpropyl substituent. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in hydrolysis reactions, where it can release hydrochloric acid upon contact with moisture. It is often used as a coupling agent or surface modifier in various applications, including adhesives, coatings, and sealants, due to its ability to enhance adhesion between organic materials and inorganic substrates. The presence of the phenyl group contributes to its hydrophobic properties, while the chlorinated silane structure allows for potential cross-linking in polymer matrices. Safety precautions are necessary when handling this compound, as it can be corrosive and may pose health risks if inhaled or ingested. Proper storage in a cool, dry place away from moisture is essential to maintain its stability and effectiveness.
Formula:C9H11Cl3Si
InChI:InChI=1S/C9H11Cl3Si/c10-13(11,12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2
InChI key:QJOHXSVBLYVERP-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)CCC[Si](Cl)(Cl)Cl
Found 2 products.