CAS 13618-92-3

1,4,5,6,7,8-Hexahydrocyclohepta[b]pyrrole

Description:

1,4,5,6,7,8-Hexahydrocyclohepta[b]pyrrole, with the CAS number 13618-92-3, is a bicyclic organic compound characterized by its unique fused ring structure. This compound features a nitrogen atom incorporated into a saturated bicyclic framework, which contributes to its potential biological activity. The presence of multiple carbon atoms in the ring system provides a degree of rigidity, influencing its chemical reactivity and interactions. Typically, such compounds exhibit moderate polarity due to the nitrogen atom, which can participate in hydrogen bonding. The saturation of the rings generally leads to stability under standard conditions, although the compound may be sensitive to oxidation or other reactive environments. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where nitrogen-containing heterocycles are often of interest. However, specific properties such as solubility, melting point, and reactivity would need to be determined through experimental data for practical applications.

Formula: C₉H₁₃N

InChI: InChI=1S/C9H13N/c1-2-4-8-6-7-10-9(8)5-3-1/h6-7,10H,1-5H2

InChI key: InChIKey=PSWWJFXURJCADQ-UHFFFAOYSA-N

SMILES: C12=C(NC=C1)CCCCC2

Synonyms:

• Cyclohepta[b]pyrrole, 1,4,5,6,7,8-hexahydro-
• 1,4,5,6,7,8-Hexahydrocyclohepta[b]pyrrole
• 1H,4H,5H,6H,7H,8H-Cyclohepta[b]pyrrole