CAS 13623-57-9
:2-(1-Naphthalenyl)-2-imidazoline
Description:
2-(1-Naphthalenyl)-2-imidazoline, with the CAS number 13623-57-9, is an organic compound characterized by its imidazoline structure fused with a naphthalene moiety. This compound typically exhibits a heterocyclic ring system, which contributes to its unique chemical properties. It is known for its potential applications in various fields, including pharmaceuticals and materials science, due to its ability to act as a ligand or a building block in organic synthesis. The presence of the naphthalene ring imparts aromatic characteristics, enhancing stability and influencing its reactivity. Additionally, the imidazoline part of the molecule can participate in various chemical reactions, such as oxidation or coordination with metal ions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Overall, 2-(1-Naphthalenyl)-2-imidazoline is a versatile compound with significant implications in both research and industrial applications.
Formula:C13H12N2
InChI:InChI=1S/C13H12N2/c1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13/h1-7H,8-9H2,(H,14,15)
InChI key:InChIKey=MDCXOIKCXHEYQK-UHFFFAOYSA-N
SMILES:C=1(C2=C(C=CC1)C=CC=C2)C=3NCCN3
Synonyms:- 2-Imidazoline, 2-(1-naphthyl)-
- 2-(Naphthalen-1-yl)imidazoline
- 2-(1-Naphthalenyl)-2-imidazoline
- 1H-Imidazole, 4,5-dihydro-2-(1-naphthalenyl)-
- 4,5-Dihydro-2-(1-naphthalenyl)-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
