CAS 136236-42-5
:glucoallosamidin B
Description:
Glucoallosamidin B is a chemical compound that belongs to the class of glycosylated amino acids. It is characterized by its unique structure, which includes a sugar moiety linked to an amino acid backbone, contributing to its biological activity. This compound is known for its potential applications in biochemistry and pharmacology, particularly in the study of enzyme inhibition and metabolic pathways. Glucoallosamidin B exhibits properties that may influence cellular processes, making it of interest in research related to diabetes and other metabolic disorders. Its specific interactions with biological targets can lead to insights into therapeutic mechanisms. Additionally, the compound's stability, solubility, and reactivity are influenced by its functional groups and stereochemistry, which are critical for its biological efficacy. As with many compounds in this category, further studies are essential to fully elucidate its mechanisms of action and potential therapeutic applications.
Formula:C25H42N4O14
InChI:InChI=1/C25H42N4O14/c1-8(32)27-14-17(35)16(34)12(7-38-4)40-23(14)42-22-11(6-31)39-24(15(19(22)37)28-9(2)33)41-21-10(5-30)20-13(18(21)36)29-25(26-3)43-20/h10-24,30-31,34-37H,5-7H2,1-4H3,(H,26,29)(H,27,32)(H,28,33)
Synonyms:- glucoallosamidin B
- beta-D-Glucopyranoside, 3a,5,6,6a-tetrahydro-4-hydroxy-6-(hydroxymethyl)-2-(methylamino)-4H-cyclopentoxazol-5-yl 2-(acetylamino)-4-O-(2-(acetylamino)-2-deoxy-6-O-methyl-beta-D-allopyranosyl)-2-deoxy-, (3aR-(3aalpha,4alpha,5beta,6alpha,6aalpha))-
- beta-D-Glucopyranoside, 3A,5,6,6A-tetrahydro-4-hydroxy-6-(hydroxymethyl)-2-(methylamino)-4H-cyclopentoxazol-5-yl 2-(acetylamino)-4-o-(2-(acetylamino)-2-deoxy-6-o-methyl-beta-D-allopyranosyl)-2-deoxy-, (3ar-(3aalpha,4alpha,5beta,6alpha,6aalpha))-
- β-D-Glucopyranoside, (3aR,4R,5R,6S,6aS)-3a,5,6,6a-tetrahydro-4-hydroxy-6-(hydroxymethyl)-2-(methylamino)-4H-cyclopentoxazol-5-yl 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxy-6-O-methyl-β-D-allopyranosyl]-2-deoxy-
- Glucoallosamidin B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glucoallosamidin B
CAS:<p>Glucoallosamidin B is a glycoside antibiotic identifiable in the Streptomyces species strain (Streptomycessp. SA-684). It functions as an inhibitor of chitinase activity. Experiments demonstrate that Glucoallosamidin B significantly inhibits the chitinase of Candida albicans (ATCC 10231), with an IC50 value of 0.8 μg/mL.</p>Formula:C25H42N4O14Color and Shape:SolidMolecular weight:622.619
