CAS 13625-33-7
:2-(3-CHLORO-PHENYLAMINO)-BENZAMIDE
Description:
2-(3-Chloro-phenylamino)-benzamide, with the CAS number 13625-33-7, is an organic compound characterized by its amide functional group and a chloro-substituted phenyl ring. This compound features a benzamide structure, where an amino group is attached to a phenyl ring that is further substituted with a chlorine atom at the meta position. The presence of the chloro group can influence the compound's reactivity and solubility, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in drug synthesis or as active pharmaceutical ingredients. The molecular structure suggests that it may engage in hydrogen bonding due to the amide group, which can affect its physical properties such as melting point and solubility in polar solvents. Overall, the characteristics of 2-(3-chloro-phenylamino)-benzamide make it a compound of interest in both synthetic chemistry and medicinal research.
Formula:C13H11ClN2O
InChI:InChI=1/C13H11ClN2O/c14-9-4-3-5-10(8-9)16-12-7-2-1-6-11(12)13(15)17/h1-8,16H,(H2,15,17)
SMILES:c1ccc(c(c1)C(=N)O)Nc1cccc(c1)Cl
Synonyms:- 2-(3-Chloroanilino)Benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
