CAS 13625-39-3
:1,3,8-TRIAZA-SPIRO[4.5]DECANE-2,4-DIONE
Description:
1,3,8-Triaza-spiro[4.5]decane-2,4-dione, with the CAS number 13625-39-3, is a heterocyclic compound characterized by its unique spiro structure, which incorporates a triazine moiety. This compound features a bicyclic framework that includes nitrogen atoms, contributing to its potential applications in various fields, including medicinal chemistry and materials science. The presence of the dione functional groups indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Its structural configuration may impart specific properties, such as solubility in polar solvents and the ability to form coordination complexes with metal ions. Additionally, the compound's nitrogen-rich structure may enhance its biological activity, making it a candidate for further research in drug development. Overall, 1,3,8-Triaza-spiro[4.5]decane-2,4-dione is a versatile compound with intriguing chemical properties and potential applications in diverse scientific domains.
Formula:C7H12N3O2
InChI:InChI=1/C7H11N3O2/c11-5-7(10-6(12)9-5)1-3-8-4-2-7/h8H,1-4H2,(H2,9,10,11,12)/p+1
Synonyms:- Iflab-Bb F2124-0748
- 2,4-Dioxo-1,3-Diaza-8-Azoniaspiro[4.5]Decane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3,8-Triazaspiro[4.5]decane-2,4-dione
CAS:Formula:C7H11N3O2Purity:95%Color and Shape:SolidMolecular weight:169.18111,3,8-Triazaspiro[4.5]decane-2,4-dione
CAS:1,3,8-Triazaspiro[4.5]decane-2,4-dionePurity:98%Molecular weight:169.18g/mol1,3,8-Triaza-spiro[4.5]decane-2,4-dione
CAS:Formula:C7H11N3O2Purity:97%Color and Shape:SolidMolecular weight:169.1841,3,8-Triaza-spiro[4.5]decane-2,4-dione
CAS:1,3,8-Triaza-spiro[4.5]decane-2,4-dione is a potential anti-cancer drug that inhibits the production of lactate and ammonium ions in lymphocytes. This leads to an increase in the oxidation of glucose and lactic acid to CO2 and H2O. The inhibition of lactate production reduces the accumulation of ammonium ions, which inhibits the activity of hydroxylases. 1,3,8-Triaza-spiro[4.5]decane-2,4-dione also targets hypoxia inducible factor (HIF) and cyclophosphamide resistance protein (CPR), leading to a decrease in the proliferation rate of lymphocytes. Ammonium carbonate is used as a stabilizing agent for this compound during crystallization.
Formula:C7H11N3O2Purity:Min. 95%Molecular weight:169.18 g/mol



