CymitQuimica logo

CAS 13626-17-0

:

Pyridine, 3,5-dibromo-4-chloro-

Description:
Pyridine, 3,5-dibromo-4-chloro- is a halogenated derivative of pyridine, characterized by the presence of two bromine atoms and one chlorine atom attached to the pyridine ring. This compound typically exhibits a pale yellow to brownish color and is known for its aromatic properties, which contribute to its stability and reactivity. The presence of halogen substituents can significantly influence its chemical behavior, making it more reactive in nucleophilic substitution reactions. It is generally soluble in organic solvents but may have limited solubility in water due to its hydrophobic nature. The compound is of interest in various fields, including organic synthesis and medicinal chemistry, where it may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this substance, as halogenated compounds can be toxic and environmentally hazardous. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.
Formula:C5H2Br2ClN
InChI:InChI=1S/C5H2Br2ClN/c6-3-1-9-2-4(7)5(3)8/h1-2H
InChI key:XNXHPEUZNXWWCH-UHFFFAOYSA-N
SMILES:C1=C(C(=C(C=N1)Br)Cl)Br
Synonyms:
  • 3,5-Dibromo-4-Chloropyridine
Found 4 products.