CAS 13626-60-3: 3-HYDROXYISOXAZOLE-5-CARBOXYLIC ACID
Description:3-Hydroxyisoxazole-5-carboxylic acid is a heterocyclic organic compound characterized by its isoxazole ring structure, which features a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. This compound possesses both hydroxyl (-OH) and carboxylic acid (-COOH) functional groups, contributing to its acidic properties and potential for hydrogen bonding. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, which enhances its reactivity in various chemical reactions. The presence of the hydroxyl group allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity. Additionally, the compound's structure suggests it could participate in various synthetic pathways, making it of interest in organic synthesis. Its CAS number, 13626-60-3, is a unique identifier that facilitates the identification and study of this specific chemical in scientific literature and databases.
Formula:C4H3NO4
InChI:InChI=1S/C4H3NO4/c6-3-1-2(4(7)8)9-5-3/h1H,(H,5,6)(H,7,8)
InChI key:InChIKey=VOCWBIGTEMMVGZ-UHFFFAOYSA-N
SMILES:O=C(O)C=1ONC(=O)C1
- Synonyms:
- 5-Isoxazolecarboxylic acid, 2,3-dihydro-3-oxo-
- 2,3-Dihydro-3-oxo-5-isoxazolecarboxylic acid
- 3-Oxo-2,3-dihydroisoxazole-5-carboxylic acid
- 3-Hydroxyisoxazole-5-carboxylic acid
- 5-Isoxazolecarboxylic acid, 3-hydroxy-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Oxo-2,3-dihydroisoxazole-5-carboxylic acid REF: 10-F044087CAS: 13626-60-3 | 95.0% | 31.00 €~58.00 € | Tue 15 Apr 25 |
![]() | 3-Hydroxyisoxazole-5-carboxylic acid REF: IN-DA00384WCAS: 13626-60-3 | 97% | 26.00 €~545.00 € | Thu 17 Apr 25 |
![]() | 3-HYDROXYISOXAZOLE-5-CARBOXYLIC ACID REF: 10-F300658CAS: 13626-60-3 | 97.0% | 14.00 €~304.00 € | Tue 22 Apr 25 |
![]() | 3-Hydroxyisoxazole-5-carboxylic acid REF: 3D-FH116688CAS: 13626-60-3 | Min. 95% | - - - | Discontinued product |

3-Oxo-2,3-dihydroisoxazole-5-carboxylic acid
Ref: 10-F044087
1g | 58.00 € | ||
250mg | 31.00 € |

3-Hydroxyisoxazole-5-carboxylic acid
Ref: IN-DA00384W
1g | 66.00 € | ||
5g | 202.00 € | ||
250mg | 26.00 € |

3-HYDROXYISOXAZOLE-5-CARBOXYLIC ACID
Ref: 10-F300658
1g | 49.00 € | ||
5g | 165.00 € | ||
10g | 304.00 € | ||
250mg | 14.00 € |

3-Hydroxyisoxazole-5-carboxylic acid
Ref: 3D-FH116688
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |