CAS 13626-61-4
:Ethyl 2,3-dihydro-3-oxo-5-isoxazolecarboxylate
Description:
Ethyl 2,3-dihydro-3-oxo-5-isoxazolecarboxylate, with the CAS number 13626-61-4, is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique reactivity and properties. This compound features a carboxylate functional group, making it a derivative of isoxazole with potential applications in organic synthesis and medicinal chemistry. The presence of the ethyl ester group enhances its solubility in organic solvents, facilitating its use in various chemical reactions. Additionally, the 2,3-dihydro-3-oxo moiety indicates that it possesses a ketone functionality, which can participate in nucleophilic addition reactions. The compound is typically stable under standard conditions but may undergo hydrolysis in the presence of strong acids or bases. Its structural characteristics suggest potential biological activity, making it a candidate for further research in drug development or as an intermediate in synthetic pathways. Overall, Ethyl 2,3-dihydro-3-oxo-5-isoxazolecarboxylate is a versatile compound with significant implications in both academic and industrial chemistry.
Formula:C6H7NO4
InChI:InChI=1S/C6H7NO4/c1-2-10-6(9)4-3-5(8)7-11-4/h3H,2H2,1H3,(H,7,8)
InChI key:InChIKey=WTLREFHTUZESDC-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1ONC(=O)C1
Synonyms:- 5-Isoxazolecarboxylic acid, 2,3-dihydro-3-oxo-, ethyl ester
- 3-Hydroxyisoxazole-5-carboxylic acid ethyl ester
- Ethyl 2,3-dihydro-3-oxo-5-isoxazolecarboxylate
- 5-Isoxazolecarboxylic acid, 3-hydroxy-, ethyl ester
- Ethyl 3-hydroxyisoxazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
