CAS 136264-28-3
:ethyl (2Z)-2-bromo-4,4,4-trifluorobut-2-enoate
Description:
Ethyl (2Z)-2-bromo-4,4,4-trifluorobut-2-enoate is an organic compound characterized by its unique structure, which includes a bromine atom and three fluorine atoms attached to a butenoate backbone. This compound features a double bond in the butenoate moiety, specifically in the Z configuration, indicating that the highest priority substituents on the double bond are on the same side. The presence of the trifluoromethyl group significantly influences its reactivity and polarity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The bromine atom serves as a good leaving group, facilitating nucleophilic substitution reactions. Ethyl (2Z)-2-bromo-4,4,4-trifluorobut-2-enoate is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its chemical properties, including reactivity and stability, are influenced by the electronegative fluorine atoms, which can enhance the compound's electrophilic character. Safety precautions should be taken when handling this compound due to its potential toxicity and reactivity.
Formula:C6H6BrF3O2
InChI:InChI=1/C6H6BrF3O2/c1-2-12-5(11)4(7)3-6(8,9)10/h3H,2H2,1H3/b4-3-
SMILES:CCOC(=O)/C(=C/C(F)(F)F)/Br
Synonyms:- Ethyl 2-Bromo-4,4,4-Trifluorobut-2-Enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.