CymitQuimica logo

CAS 1362703-18-1

:

4-[(2,6-Dimethyl-3-pyridinyl)oxy]benzenamine

Description:
4-[(2,6-Dimethyl-3-pyridinyl)oxy]benzenamine, with the CAS number 1362703-18-1, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group and an ether linkage to a pyridine derivative. The presence of the dimethyl groups on the pyridine ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit properties typical of amines and ethers, such as potential basicity due to the amino group and the ability to participate in hydrogen bonding. Its molecular structure suggests it may be involved in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, given the presence of both aromatic and heterocyclic components, which are often associated with bioactive molecules. However, specific data regarding its solubility, stability, and reactivity would require further investigation through experimental studies.
Formula:C13H14N2O
InChI:InChI=1S/C13H14N2O/c1-9-3-8-13(10(2)15-9)16-12-6-4-11(14)5-7-12/h3-8H,14H2,1-2H3
InChI key:InChIKey=GUORGPOXIBXQLK-UHFFFAOYSA-N
SMILES:O(C1=C(C)N=C(C)C=C1)C2=CC=C(N)C=C2
Synonyms:
  • Benzenamine, 4-[(2,6-dimethyl-3-pyridinyl)oxy]-
  • 4-[(2,6-Dimethyl-3-pyridinyl)oxy]benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.