CAS 136274-57-2: (r,r'')-2,2''-bis(diphenylphosphino)-1,1''-biferrocene
Description:(r,r'')-2,2''-bis(diphenylphosphino)-1,1''-biferrocene, with CAS number 136274-57-2, is a biferrocene derivative characterized by the presence of two diphenylphosphino groups attached to a biferrocene backbone. This compound exhibits notable properties due to the presence of both ferrocene units, which contribute to its redox activity, and the phosphine ligands, which can participate in coordination chemistry. The biferrocene structure imparts significant stability and rigidity, while the diphenylphosphino groups enhance its ability to act as a bidentate ligand in metal complexes. This compound is often utilized in catalysis and materials science due to its electronic properties and potential applications in organic synthesis. Additionally, the chirality of the phosphine groups can lead to interesting stereochemical outcomes in reactions. Overall, (r,r'')-2,2''-bis(diphenylphosphino)-1,1''-biferrocene is a versatile compound with implications in various fields of chemistry, particularly in coordination chemistry and catalysis.
Formula:C44H36Fe2P2
InChI:InChI=1/C34H26P2.2C5H5.2Fe/c1-5-15-27(16-6-1)35(28-17-7-2-8-18-28)33-25-13-23-31(33)32-24-14-26-34(32)36(29-19-9-3-10-20-29)30-21-11-4-12-22-30;2*1-2-4-5-3-1;;/h1-26H;2*1-5H;;/rC44H36Fe2P2/c1-5-21-35(22-6-1)47(36-23-7-2-8-24-36)41-31-29-39(45-33-17-13-14-18-33)43(41)44-40(46-34-19-15-16-20-34)30-32-42(44)48(37-25-9-3-10-26-37)38-27-11-4-12-28-38/h1-34,39-40H
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (R,R'')-2,2''-Bis(diphenylphosphino)-1,1''-biferrocene REF: 3B-B3196CAS: 136274-57-2 | >98.0%(T) | 196.00 €~741.00 € | Tue 08 Apr 25 |
![]() | (R,R)-2,2-Bis(diphenylphosphino)-1,1-biferrocene REF: IN-DA003CCFCAS: 136274-57-2 | 98.0% | To inquire | Tue 15 Apr 25 |
![]() | (R,R'')-2,2''-Bis(diphenylphosphino)-1,1''-biferrocene REF: 3D-FB60778CAS: 136274-57-2 | Min. 95% | - - - | Discontinued product |

(R,R'')-2,2''-Bis(diphenylphosphino)-1,1''-biferrocene
Ref: 3B-B3196
100mg | 196.00 € | ||
500mg | 741.00 € |

(R,R)-2,2-Bis(diphenylphosphino)-1,1-biferrocene
Ref: IN-DA003CCF
Undefined size | To inquire |

(R,R'')-2,2''-Bis(diphenylphosphino)-1,1''-biferrocene
Ref: 3D-FB60778
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |