CAS 13630-56-3

3-[2-(2-Propen-1-yloxy)ethoxy]propanoic acid

Description:

3-[2-(2-Propen-1-yloxy)ethoxy]propanoic acid, identified by its CAS number 13630-56-3, is an organic compound characterized by its functional groups, which include a carboxylic acid and an ether. This substance features a propanoic acid backbone, which contributes to its acidity and reactivity. The presence of the propenyloxy group indicates that it can participate in various chemical reactions, such as polymerization, making it useful in the synthesis of polymers and copolymers. The ether functionality provides solubility in organic solvents, enhancing its applicability in various formulations. Additionally, the compound's structure suggests potential uses in the production of surfactants, emulsifiers, or as a reactive diluent in coatings and adhesives. Its reactivity and functional versatility make it a valuable intermediate in organic synthesis and materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₄O₄

InChI: InChI=1S/C8H14O4/c1-2-4-11-6-7-12-5-3-8(9)10/h2H,1,3-7H2,(H,9,10)

InChI key: InChIKey=DAYGNAZGJAYJCF-UHFFFAOYSA-N

SMILES: O(CCOCC=C)CCC(O)=O

Synonyms:

• 3-[2-(2-Propen-1-yloxy)ethoxy]propanoic acid
• Propanoic acid, 3-[2-(2-propen-1-yloxy)ethoxy]-
• Propionic acid, 3-[2-(allyloxy)ethoxy]-