CAS 136309-08-5

Ethyl 6-methoxy-2-pyrazinecarboxylate

Description:

Ethyl 6-methoxy-2-pyrazinecarboxylate is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of a methoxy group at the 6-position of the pyrazine ring enhances its reactivity and may influence its biological activity. Ethyl 6-methoxy-2-pyrazinecarboxylate is typically a colorless to pale yellow liquid with a distinctive odor, often associated with its use in flavoring and fragrance applications. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, as compounds with similar frameworks have been explored for various biological activities. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₈H₁₀N₂O₃

InChI: InChI=1S/C8H10N2O3/c1-3-13-8(11)6-4-9-5-7(10-6)12-2/h4-5H,3H2,1-2H3

InChI key: InChIKey=JYOGJLQLLUNMRY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=NC(OC)=CN=C1

Synonyms:

• Pyrazinecarboxylic acid, 6-methoxy-, ethyl ester
• 2-Pyrazinecarboxylic acid, 6-methoxy-, ethyl ester
• Ethyl 6-methoxy-2-pyrazinecarboxylate