
CAS 136309-14-3
:5-Methoxy-N,N-dimethyl-2-pyrazinamine
Description:
5-Methoxy-N,N-dimethyl-2-pyrazinamine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a methoxy group (-OCH3) and two dimethylamino groups (-N(CH3)2) attached to the pyrazine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the methoxy and dimethylamino groups, which can engage in hydrogen bonding. The presence of nitrogen atoms in the pyrazine ring can also influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, compounds with similar structures are often investigated for their biological activities, including potential pharmaceutical applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H11N3O
InChI:InChI=1S/C7H11N3O/c1-10(2)6-4-9-7(11-3)5-8-6/h4-5H,1-3H3
InChI key:InChIKey=LNKPVHCHJHAYEV-UHFFFAOYSA-N
SMILES:N(C)(C)C=1C=NC(OC)=CN1
Synonyms:- 5-Methoxy-N,N-dimethyl-2-pyrazinamine
- Pyrazinamine, 5-methoxy-N,N-dimethyl-
- 2-Pyrazinamine, 5-methoxy-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.