CAS 136315-77-0
:(1R,2R)-2-amino cyclopetanecarboxylic acid
Description:
(1R,2R)-2-amino cyclopentanecarboxylic acid, also known as a cyclic amino acid, is characterized by its unique ring structure, which consists of a five-membered cyclopentane ring with an amino group and a carboxylic acid functional group attached. This compound exhibits chirality due to the presence of two stereogenic centers, resulting in specific optical isomers. The amino group contributes to its basicity, while the carboxylic acid group imparts acidic properties, allowing it to participate in various biochemical reactions. Its structural features enable it to potentially act as a building block in peptide synthesis or as a ligand in coordination chemistry. Additionally, the compound's solubility in polar solvents and its ability to form hydrogen bonds can influence its reactivity and interactions in biological systems. Overall, (1R,2R)-2-amino cyclopentanecarboxylic acid is of interest in both synthetic organic chemistry and medicinal chemistry due to its potential applications in drug development and as a chiral auxiliary.
Formula:C6H11NO2
InChI:InChI=1/C6H11NO2/c7-5-3-1-2-4(5)6(8)9/h4-5H,1-3,7H2,(H,8,9)/t4-,5-/m1/s1
SMILES:C1C[C@H]([C@@H](C1)N)C(=O)O
Synonyms:- (1R,2R)-2-aminocyclopetanecarboxylic acid
- (1R,2R)-2-aminocyclopentanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
