CAS 1363166-08-8

4-[(2,4-Dichlorobenzoyl)amino]-3-methylphenyl 2,4-dichlorobenzoate

Description:

4-[(2,4-Dichlorobenzoyl)amino]-3-methylphenyl 2,4-dichlorobenzoate, identified by its CAS number 1363166-08-8, is a chemical compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This substance features a dichlorobenzoyl moiety attached to an amino group, indicating potential applications in pharmaceuticals or agrochemicals due to its bioactive properties. The presence of multiple chlorine atoms suggests that it may exhibit significant hydrophobic characteristics, influencing its solubility and reactivity. Additionally, the methyl group on the phenyl ring can affect the compound's electronic properties and steric hindrance, potentially impacting its interactions with biological targets. The compound's synthesis and stability may be influenced by the presence of the dichlorobenzoate group, which can also play a role in its overall reactivity. Overall, this compound's unique structural features may contribute to its potential utility in various chemical applications, although specific biological activities and safety profiles would require further investigation.

Formula: C₂₁H₁₃Cl₄NO₃

InChI: InChI=1S/C21H13Cl4NO3/c1-11-8-14(29-21(28)16-6-3-13(23)10-18(16)25)4-7-19(11)26-20(27)15-5-2-12(22)9-17(15)24/h2-10H,1H3,(H,26,27)

InChI key: InChIKey=ZNGIXBMPSLXUOP-UHFFFAOYSA-N

SMILES: N(C(=O)C1=C(Cl)C=C(Cl)C=C1)C2=C(C)C=C(OC(=O)C3=C(Cl)C=C(Cl)C=C3)C=C2

Synonyms:

• 4-[(2,4-Dichlorobenzoyl)amino]-3-methylphenyl 2,4-dichlorobenzoate
• Benzoic acid, 2,4-dichloro-, 4-[(2,4-dichlorobenzoyl)amino]-3-methylphenyl ester
• 4-(2,4-Dichlorobenzamido)-3-methylphenyl 2,4-dichlorobenzoate
• 2,4-Dichloro-N-[4-(2,4-dichlorobenzoyloxy)-2-Methylphenyl]benzaMide

Benzoic acid, 2,4-dichloro-, 4-[(2,4-dichlorobenzoyl)amino]-3-methylphenyl ester

CAS: 1363166-08-8

Formula: C₂₁H₁₃Cl₄NO₃

Purity: 95%

Molecular weight: 469.1448

Ref: IN-DA0011MW