CAS 1363166-10-2

Methyl 3,5-dibromo-2-[(2,2,2-trifluoroacetyl)amino]benzoate

Description:

Methyl 3,5-dibromo-2-[(2,2,2-trifluoroacetyl)amino]benzoate is a synthetic organic compound characterized by its complex structure, which includes a benzoate moiety substituted with bromine and an amino group. The presence of two bromine atoms at the 3 and 5 positions of the benzene ring enhances its reactivity and potential biological activity. The trifluoroacetyl group contributes to the compound's lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit properties typical of halogenated organic compounds, such as increased stability and potential toxicity. Its applications may span various fields, including medicinal chemistry and agrochemicals, where it could serve as an intermediate or active ingredient. The specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which the compound is used. As with many halogenated compounds, safety and environmental considerations are crucial due to the potential for bioaccumulation and toxicity.

Formula: C₁₀H₆Br₂F₃NO₃

InChI: InChI=1S/C10H6Br2F3NO3/c1-19-8(17)5-2-4(11)3-6(12)7(5)16-9(18)10(13,14)15/h2-3H,1H3,(H,16,18)

InChI key: InChIKey=CFFDNUDERDYOFI-UHFFFAOYSA-N

SMILES: N(C(C(F)(F)F)=O)C1=C(C(OC)=O)C=C(Br)C=C1Br

Synonyms:

• Benzoic acid, 3,5-dibromo-2-[(2,2,2-trifluoroacetyl)amino]-, methyl ester
• Methyl 3,5-dibromo-2-[(2,2,2-trifluoroacetyl)amino]benzoate

Benzoic acid, 3,5-dibromo-2-[(2,2,2-trifluoroacetyl)amino]-, methyl ester

CAS: 1363166-10-2

Formula: C₁₀H₆Br₂F₃NO₃

Purity: 95%

Molecular weight: 404.9627

Ref: IN-DA0011MV

Methyl 3,5-dibromo-2-(2,2,2-trifluoroacetamido)benzoate

CAS: 1363166-10-2

Purity: >95%

Molecular weight: 404.9649963

Ref: 10-F721316