CAS 1363210-25-6

4,5,6,7-Tetrahydro-2,1-benzisoxazole-3-methanol

Description:

4,5,6,7-Tetrahydro-2,1-benzisoxazole-3-methanol is a chemical compound characterized by its unique bicyclic structure, which includes a benzisoxazole moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a methanol group that contributes to its reactivity and solubility properties. The presence of the isoxazole ring suggests potential biological activity, as many compounds containing this functional group are known for their pharmacological properties. The molecular structure allows for various interactions, including hydrogen bonding, which can influence its solubility in polar solvents. Additionally, the compound may exhibit interesting properties such as moderate stability under standard conditions, but its reactivity can vary based on environmental factors. Its CAS number, 1363210-25-6, serves as a unique identifier for regulatory and research purposes. Overall, 4,5,6,7-Tetrahydro-2,1-benzisoxazole-3-methanol is a compound of interest in medicinal chemistry and material science due to its structural features and potential applications.

Formula: C₈H₁₁NO₂

InChI: InChI=1S/C8H11NO2/c10-5-8-6-3-1-2-4-7(6)9-11-8/h10H,1-5H2

InChI key: InChIKey=ATQYGVCVGUFDOG-UHFFFAOYSA-N

SMILES: C(O)C1=C2C(=NO1)CCCC2

Synonyms:

• 4,5,6,7-Tetrahydro-2,1-benzisoxazole-3-methanol
• 2,1-Benzisoxazole-3-methanol, 4,5,6,7-tetrahydro-

(4,5,6,7-Tetrahydrobenzo[c]isoxazol-3-yl)methanol

CAS: 1363210-25-6

Formula: C₈H₁₁NO₂

Purity: 95%

Molecular weight: 153.1784

Ref: IN-DA00HUI9

(4,5,6,7-TETRAHYDROBENZO[C]ISOXAZOL-3-YL)METHANOL

CAS: 1363210-25-6

Formula: C₈H₁₁NO₂

Purity: 95.0%

Molecular weight: 153.181

Ref: 10-F469566