CymitQuimica logo

CAS 1363210-27-8

:

Ethyl 3-methyl-5-propyl-4-isoxazolecarboxylate

Description:
Ethyl 3-methyl-5-propyl-4-isoxazolecarboxylate is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features an ethyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the 3-methyl and 5-propyl substituents on the isoxazole ring influences its physical and chemical properties, such as boiling point, melting point, and polarity. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be affected by environmental conditions, such as pH and temperature. Overall, Ethyl 3-methyl-5-propyl-4-isoxazolecarboxylate represents a unique class of organic compounds with diverse applications in various fields, including drug development and synthetic chemistry.
Formula:C10H15NO3
InChI:InChI=1S/C10H15NO3/c1-4-6-8-9(7(3)11-14-8)10(12)13-5-2/h4-6H2,1-3H3
InChI key:InChIKey=WAPVSAGFVAIVRD-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(CCC)ON=C1C
Synonyms:
  • Ethyl 3-methyl-5-propyl-4-isoxazolecarboxylate
  • 4-Isoxazolecarboxylic acid, 3-methyl-5-propyl-, ethyl ester
  • Ethyl 3-Methyl-5-Propylisoxazole-4-Carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.