CAS 1363210-33-6

Cyclopentapyrazole, 3-(chloromethyl)-1,4,5,6-tetrahydro-, hydrochloride (1:1)

Description:

Cyclopentapyrazole, 3-(chloromethyl)-1,4,5,6-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a cyclopentane moiety. The presence of a chloromethyl group enhances its reactivity, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in biological studies and pharmaceutical formulations. The compound may exhibit biological activity, potentially influencing various physiological processes, although specific pharmacological properties would require further investigation. Its CAS number, 1363210-33-6, allows for precise identification and retrieval of information regarding its synthesis, properties, and applications in scientific literature. Overall, this compound represents a class of heterocyclic compounds that are of interest in both synthetic and medicinal chemistry due to their diverse chemical behavior and potential therapeutic applications.

Formula: C₇H₉ClN₂·ClH

InChI: InChI=1S/C7H9ClN2.ClH/c8-4-7-5-2-1-3-6(5)9-10-7;/h1-4H2,(H,9,10);1H

InChI key: InChIKey=QBPRVJHZXQFTLH-UHFFFAOYSA-N

SMILES: C(Cl)C=1C2=C(NN1)CCC2.Cl

Synonyms:

• Cyclopentapyrazole, 3-(chloromethyl)-1,4,5,6-tetrahydro-, hydrochloride (1:1)

3-(CHLOROMETHYL)-1H,4H,5H,6H-CYCLOPENTA[C]PYRAZOLE HCL

CAS: 1363210-33-6

Formula: C₇H₁₀Cl₂N₂

Purity: 95.0%

Molecular weight: 193.07

Ref: 10-F469561

3-(Chloromethyl)-1h,4h,5h,6h-cyclopenta[c]pyrazole hydrochloride

CAS: 1363210-33-6

Versatile small molecule scaffold

Formula: C₇H₉N₂Cl·HCl

Purity: Min. 95%

Molecular weight: 193.07 g/mol

Ref: 3D-NEC21033