CAS 136334-84-4

2,5-diethoxy-4-morpholinoaniline dihydro-chloride

Description:

2,5-Diethoxy-4-morpholinoaniline dihydrochloride is a chemical compound characterized by its complex structure, which includes an aniline core substituted with two ethoxy groups and a morpholino group. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which is indicative of its polar functional groups. The presence of the morpholino group suggests potential applications in pharmaceuticals or as a building block in organic synthesis due to its ability to participate in various chemical reactions. The dihydrochloride form indicates that the compound exists as a salt, enhancing its stability and solubility. Its molecular structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety measures are in place. Overall, 2,5-diethoxy-4-morpholinoaniline dihydrochloride is a versatile compound with potential applications in various fields of chemistry and biology.

Formula: C₁₄H₂₄Cl₂N₂O₃

InChI: InChI=1/C14H22N2O3.2ClH/c1-3-18-13-10-12(16-5-7-17-8-6-16)14(19-4-2)9-11(13)15;;/h9-10H,3-8,15H2,1-2H3;2*1H

SMILES: CCOc1cc(c(cc1N)OCC)N1CCOCC1.Cl.Cl

Synonyms:

• 2,5-Diethoxy-4-morpholinoaniline dihydrochloride
• 2,5-Diethoxy-4-(Morpholin-4-Yl)Aniline Dihydrochloride

2,5-Diethoxy-4-(morpholin-4-yl)aniline dihydrochloride

CAS: 136334-84-4

2,5-Diethoxy-4-(morpholin-4-yl)aniline dihydrochloride

Purity: ≥95%

Color and Shape: Grey Powder

Molecular weight: 339.26g/mol

Ref: 54-OR60195