
CAS 1363380-50-0
:1-Methyl-1,3,7-triazaspiro[4.5]decan-4-one
Description:
1-Methyl-1,3,7-triazaspiro[4.5]decan-4-one is a heterocyclic organic compound characterized by its unique spirocyclic structure, which incorporates a combination of nitrogen atoms within a bicyclic framework. The presence of three nitrogen atoms in the triaza configuration contributes to its potential as a ligand in coordination chemistry and may influence its reactivity and interaction with other chemical species. The compound features a carbonyl group (ketone) at the 4-position, which can participate in various chemical reactions, including nucleophilic attacks. Its methyl group at the 1-position enhances its lipophilicity, potentially affecting its solubility and biological activity. The spiro structure often imparts rigidity to the molecule, which can be advantageous in drug design, as it may improve binding affinity to biological targets. Overall, 1-Methyl-1,3,7-triazaspiro[4.5]decan-4-one exhibits interesting chemical properties that may be explored in medicinal chemistry and materials science.
Formula:C8H15N3O
InChI:InChI=1S/C8H15N3O/c1-11-6-10-7(12)8(11)3-2-4-9-5-8/h9H,2-6H2,1H3,(H,10,12)
InChI key:InChIKey=PEYTVQLGZBLYLS-UHFFFAOYSA-N
SMILES:O=C1C2(N(C)CN1)CCCNC2
Synonyms:- 1,3,7-Triazaspiro[4.5]decan-4-one, 1-methyl-
- 1-Methyl-1,3,7-triazaspiro[4.5]decan-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.