CAS 1363380-53-3
:2-Chloro-5-iodo-3,4-pyridinediamine
Description:
2-Chloro-5-iodo-3,4-pyridinediamine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both chlorine and iodine atoms, as well as amino groups. The molecular structure features a pyridine core, which is a six-membered aromatic ring containing one nitrogen atom. The chlorine and iodine substituents are located at the 2 and 5 positions, respectively, while the amino groups are positioned at the 3 and 4 positions of the ring. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino groups, which can engage in hydrogen bonding. Its unique substitution pattern may impart specific reactivity and biological activity, making it of interest in medicinal chemistry and material science. Additionally, the presence of halogens can influence the compound's electronic properties and stability. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact.
Formula:C5H5ClIN3
InChI:InChI=1S/C5H5ClIN3/c6-5-4(9)3(8)2(7)1-10-5/h1H,9H2,(H2,8,10)
InChI key:InChIKey=TWRVSQKIUZSZTA-UHFFFAOYSA-N
SMILES:NC=1C(N)=C(Cl)N=CC1I
Synonyms:- 3,4-Pyridinediamine, 2-chloro-5-iodo-
- 2-Chloro-5-iodo-3,4-pyridinediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.