CymitQuimica logo

CAS 1363380-54-4

:

Methyl 1H-pyrazolo[4,3-c]pyridine-7-carboxylate

Description:
Methyl 1H-pyrazolo[4,3-c]pyridine-7-carboxylate is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a methyl ester functional group, which contributes to its reactivity and solubility properties. The presence of the pyrazole ring imparts unique electronic characteristics, making it of interest in medicinal chemistry and drug development. Typically, compounds of this nature exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or as lead compounds in drug discovery. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its solubility in organic solvents and moderate stability under standard conditions make it suitable for various applications in research and industry. Additionally, the compound's specific interactions with biological targets can be explored through further studies, potentially leading to the development of novel therapeutic agents. Overall, Methyl 1H-pyrazolo[4,3-c]pyridine-7-carboxylate represents a valuable compound in the field of organic and medicinal chemistry.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-13-8(12)6-4-9-2-5-3-10-11-7(5)6/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=MONOGFRRZIGFQZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=CN=C1)C=NN2
Synonyms:
  • Methyl 1H-pyrazolo[4,3-c]pyridine-7-carboxylate
  • 1H-Pyrazolo[4,3-c]pyridine-7-carboxylic acid, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.