CAS 1363380-70-4
:3-Methyl-1H-pyrrolo[2,3-b]pyridin-4-amine
Description:
3-Methyl-1H-pyrrolo[2,3-b]pyridin-4-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a methyl group at the 3-position of the pyrrole ring and an amino group at the 4-position of the pyridine ring enhances its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been investigated for their roles as kinase inhibitors and in other therapeutic areas. Additionally, the compound's molecular geometry and electronic properties may influence its interaction with biological targets, making it a subject of interest in drug discovery and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-5-4-11-8-7(5)6(9)2-3-10-8/h2-4H,1H3,(H3,9,10,11)
InChI key:InChIKey=MSPDBEMMMAWEQM-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=C1)NC=C2C
Synonyms:- 1H-Pyrrolo[2,3-b]pyridin-4-amine, 3-methyl-
- 3-Methyl-1H-pyrrolo[2,3-b]pyridin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Amino-3-methyl-7-azaindole
CAS:Controlled ProductFormula:C8H9N3Color and Shape:NeatMolecular weight:147.177
