CAS 1363380-87-3

4-Bromo-2-methyl-2H-indazole-3-sulfonyl chloride

Description:

4-Bromo-2-methyl-2H-indazole-3-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a bromine atom and a methyl group attached to the indazole ring, contributing to its unique chemical properties. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in various nucleophilic substitution reactions. It is typically used in the synthesis of pharmaceuticals and agrochemicals, where it can act as a building block for more complex molecules. The compound is likely to be a solid at room temperature and may require careful handling due to the potential for reactivity with moisture and nucleophiles. Safety precautions should be taken when working with this substance, as sulfonyl chlorides can release toxic gases upon hydrolysis. Overall, 4-Bromo-2-methyl-2H-indazole-3-sulfonyl chloride is a valuable intermediate in synthetic organic chemistry.

Formula: C₈H₆BrClN₂O₂S

InChI: InChI=1S/C8H6BrClN2O2S/c1-12-8(15(10,13)14)7-5(9)3-2-4-6(7)11-12/h2-4H,1H3

InChI key: InChIKey=ZSFHIGZLROQHTA-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C2C(=NN1C)C=CC=C2Br

Synonyms:

• 4-Bromo-2-methyl-2H-indazole-3-sulfonyl chloride
• 2H-Indazole-3-sulfonyl chloride, 4-bromo-2-methyl-