CAS 1363380-96-4

5-Bromo-1-methyl-1H-indazole-3-carboxylic acid

Description:

5-Bromo-1-methyl-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and a carboxylic acid functional group at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. The methyl group at the 1-position enhances its lipophilicity, which can influence its biological activity and solubility. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced efficacy or selectivity. Additionally, the presence of the carboxylic acid group suggests potential for forming salts or esters, which can be useful in formulation chemistry. Overall, 5-Bromo-1-methyl-1H-indazole-3-carboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₇BrN₂O₂

InChI: InChI=1S/C9H7BrN2O2/c1-12-7-3-2-5(10)4-6(7)8(11-12)9(13)14/h2-4H,1H3,(H,13,14)

InChI key: InChIKey=PRXFQVZMBVERDQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(N(C)N1)=CC=C(Br)C2

Synonyms:

• 5-Bromo-1-methyl-1H-indazole-3-carboxylic acid
• 1H-Indazole-3-carboxylic acid, 5-bromo-1-methyl-

5-Bromo-1-methyl-indazole-3-carboxylic acid

CAS: 1363380-96-4

Formula: C₉H₇BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 255.0681

Ref: IN-DA00HUJG

5-Bromo-1-methyl-1H-indazole-3-carboxylic acid

CAS: 1363380-96-4

5-Bromo-1-methyl-1H-indazole-3-carboxylic acid

Molecular weight: 255.06808g/mol

Ref: 54-OR1021795

5-Bromo-1-methyl-1H-indazole-3-carboxylic acid

CAS: 1363380-96-4

Formula: C₉H₇BrN₂O₂

Purity: 97%

Molecular weight: 255.071

Ref: 10-F496936

5-Bromo-1-methyl-1H-indazole-3-carboxylic Acid

Controlled Product

CAS: 1363380-96-4

Please enquire for more information about 5-Bromo-1-methyl-1H-indazole-3-carboxylic Acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₇N₂O₂Br

Purity: Min. 95%

Molecular weight: 255.06 g/mol

Ref: 3D-NEC38096