CAS 1363381-00-3
:trans-3-Methoxycyclobutanamine
Description:
Trans-3-Methoxycyclobutanamine is a cyclic amine characterized by its unique four-membered ring structure, which includes a methoxy group (-OCH3) and an amine group (-NH2) attached to the cyclobutane ring. This compound exhibits chirality due to the presence of a stereocenter, resulting in distinct enantiomers that may have different biological activities. The methoxy group contributes to the compound's polarity and can influence its solubility in various solvents. Trans-3-Methoxycyclobutanamine may participate in hydrogen bonding due to the amine functionality, affecting its reactivity and interactions with other molecules. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where cyclic amines are often explored for their biological properties. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and pH, making it important to consider these conditions in experimental settings. Overall, trans-3-Methoxycyclobutanamine represents a fascinating subject for further research in organic and medicinal chemistry.
Formula:C5H11NO
InChI:InChI=1/C5H11NO/c1-7-5-2-4(6)3-5/h4-5H,2-3,6H2,1H3/t4-,5-
InChI key:InChIKey=CTZHBPUHGUPFSN-URHBZAFANA-N
SMILES:O(C)[C@H]1C[C@H](N)C1
Synonyms:- trans-3-Methoxycyclobutanamine
- Cyclobutanamine, 3-methoxy-, trans-
- (trans-3-Methoxycyclobutyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R,3R)-3-Methoxycyclobutan-1-amine Hydrochloride
CAS:Controlled ProductFormula:C5H11NO·HClColor and Shape:NeatMolecular weight:137.608
