CymitQuimica logo

CAS 1363381-06-9

:

1-Methyl-7-nitro-1H-indazole-3-carboxylic acid

Description:
1-Methyl-7-nitro-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methyl group at the 1-position and a nitro group at the 7-position contributes to its unique reactivity and properties. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential biological activity. Its molecular structure allows for various interactions with biological targets, making it of interest in drug development. Additionally, the nitro group can participate in reduction reactions, which may lead to the formation of different derivatives. Overall, 1-Methyl-7-nitro-1H-indazole-3-carboxylic acid exhibits characteristics that make it a valuable compound for further study in chemical and pharmaceutical applications.
Formula:C9H7N3O4
InChI:InChI=1S/C9H7N3O4/c1-11-8-5(7(10-11)9(13)14)3-2-4-6(8)12(15)16/h2-4H,1H3,(H,13,14)
InChI key:InChIKey=UTCNKUIJBXIDOB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=C(N(=O)=O)C=CC2)N(C)N1
Synonyms:
  • 1H-Indazole-3-carboxylic acid, 1-methyl-7-nitro-
  • 1-Methyl-7-nitro-1H-indazole-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.