CAS 1363381-21-8

3-Methyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid

Description:

3-Methyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its acidity and reactivity. The presence of the methyl group at the 3-position of the pyrrole ring influences its steric and electronic properties, potentially affecting its interactions in biological systems. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their biological activities. Additionally, the compound's CAS number, 1363381-21-8, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, 3-Methyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid represents a valuable structure in the field of organic chemistry and drug discovery.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-5-4-11-8-7(5)6(9(12)13)2-3-10-8/h2-4H,1H3,(H,10,11)(H,12,13)

InChI key: InChIKey=WJEWWFBHUOCCBF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=NC=C1)NC=C2C

Synonyms:

• 3-Methyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid
• 1H-Pyrrolo[2,3-b]pyridine-4-carboxylic acid, 3-methyl-
• 3-Methyl-7-azaindole-4-carboxylic acid