CymitQuimica logo

CAS 1363381-25-2

:

3-(3-Bromophenyl)-3-oxetanecarboxaldehyde

Description:
3-(3-Bromophenyl)-3-oxetanecarboxaldehyde is a chemical compound characterized by its oxetane ring structure, which is a four-membered cyclic ether. The presence of a bromophenyl group indicates that there is a bromine atom attached to a phenyl ring, contributing to the compound's reactivity and potential applications in organic synthesis. The aldehyde functional group (-CHO) is also present, which is known for its reactivity in various chemical reactions, including nucleophilic addition and oxidation. This compound may exhibit unique physical properties such as specific melting and boiling points, solubility in organic solvents, and potential for forming hydrogen bonds due to the aldehyde group. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the presence of the bromine atom may enhance its biological activity or influence its interaction with other molecules. As with any chemical substance, safety precautions should be taken when handling it, considering its potential hazards.
Formula:C10H9BrO2
InChI:InChI=1S/C10H9BrO2/c11-9-3-1-2-8(4-9)10(5-12)6-13-7-10/h1-5H,6-7H2
InChI key:InChIKey=NHUHQYFRHUGROL-UHFFFAOYSA-N
SMILES:C(=O)C1(COC1)C2=CC(Br)=CC=C2
Synonyms:
  • 3-(3-Bromophenyl)oxetan-3-carboxaldehyde
  • 3-Oxetanecarboxaldehyde, 3-(3-bromophenyl)-
  • 3-(3-Bromophenyl)-3-oxetanecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.