CAS 1363381-31-0
:7-Thia-2-azaspiro[3.5]nonane, 7,7-dioxide
Description:
7-Thia-2-azaspiro[3.5]nonane, 7,7-dioxide is a chemical compound characterized by its unique spirocyclic structure, which includes a sulfur atom (thia) and a nitrogen atom (aza) within its framework. The compound features a bicyclic system that contributes to its rigidity and potential biological activity. The presence of the 7,7-dioxide functional group indicates that there are two double-bonded oxygen atoms attached to the sulfur atom, which can influence the compound's reactivity and solubility. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its specific interactions with biological targets can be explored further through experimental studies. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and behavior in various environments would be important for applications in drug development or material science. Overall, 7-Thia-2-azaspiro[3.5]nonane, 7,7-dioxide represents a class of compounds that could have significant implications in various fields of research.
Formula:C7H13NO2S
InChI:InChI=1S/C7H13NO2S/c9-11(10)3-1-7(2-4-11)5-8-6-7/h8H,1-6H2
InChI key:InChIKey=JDSIKUYJPSNJFG-UHFFFAOYSA-N
SMILES:O=S1(=O)CCC2(CC1)CNC2
Synonyms:- 7-Thia-2-azaspiro[3.5]nonane, 7,7-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.