CAS 1363381-37-6
:3-Bromo-2-methyl-2H-pyrazolo[3,4-b]pyridin-4-amine
Description:
3-Bromo-2-methyl-2H-pyrazolo[3,4-b]pyridin-4-amine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both bromine and amino functional groups. This compound features a bromine atom at the 3-position and a methyl group at the 2-position of the pyrazolo ring, contributing to its unique reactivity and potential biological activity. The presence of the amino group at the 4-position enhances its ability to participate in hydrogen bonding, making it a candidate for various chemical reactions and applications in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which may lead to pharmacological effects. The compound is likely to exhibit moderate solubility in organic solvents, and its stability can be influenced by the presence of the bromine substituent. As with many heterocycles, it may also display interesting electronic properties due to the conjugated system within the ring structure. Overall, 3-Bromo-2-methyl-2H-pyrazolo[3,4-b]pyridin-4-amine is of interest for further research in drug development and synthetic chemistry.
Formula:C7H7BrN4
InChI:InChI=1S/C7H7BrN4/c1-12-6(8)5-4(9)2-3-10-7(5)11-12/h2-3H,9H2,1H3
InChI key:InChIKey=UYEMFLMLPQXQHD-UHFFFAOYSA-N
SMILES:BrC1=C2C(=NN1C)N=CC=C2N
Synonyms:- 3-Bromo-2-methyl-2H-pyrazolo[3,4-b]pyridin-4-amine
- 2H-Pyrazolo[3,4-b]pyridin-4-amine, 3-bromo-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.