CAS 1363381-44-5

Benzo[b]thiophene-6-methanamine, 2,3-dihydro-, 1,1-dioxide

Description:

Benzo[b]thiophene-6-methanamine, 2,3-dihydro-, 1,1-dioxide, identified by its CAS number 1363381-44-5, is a chemical compound that features a fused ring system comprising a benzo[b]thiophene moiety. This structure contributes to its aromatic characteristics and potential biological activity. The presence of the methanamine group indicates that it has an amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The "1,1-dioxide" designation suggests that the compound contains sulfone functionalities, which can enhance its solubility and reactivity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₉H₁₁NO₂S

InChI: InChI=1S/C9H11NO2S/c10-6-7-1-2-8-3-4-13(11,12)9(8)5-7/h1-2,5H,3-4,6,10H2

InChI key: InChIKey=ILRFVMUJNYMFHT-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(CC1)=CC=C(CN)C2

Synonyms:

• Benzo[b]thiophene-6-methanamine, 2,3-dihydro-, 1,1-dioxide

(1,1-DIOXO-2,3-DIHYDRO-1H-BENZO[B]THIOPHEN-6-YL)METHYLAMINE

CAS: 1363381-44-5

Formula: C₉H₁₁NO₂S

Purity: 95.0%

Molecular weight: 197.25

Ref: 10-F503177