CAS 1363381-48-9

Methyl 4-bromo-1H-pyrazolo[3,4-c]pyridine-3-carboxylate

Description:

Methyl 4-bromo-1H-pyrazolo[3,4-c]pyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates a bromine atom at the 4-position of the pyrazole ring. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various synthetic processes. The bromine substituent can serve as a site for further chemical modifications, allowing for the development of derivatives with tailored biological activities. Methyl 4-bromo-1H-pyrazolo[3,4-c]pyridine-3-carboxylate may exhibit interesting pharmacological properties, making it a candidate for research in drug discovery. Its unique structural features and functional groups suggest potential applications in the synthesis of bioactive molecules, particularly in the fields of pharmaceuticals and agrochemicals. As with many heterocycles, its stability and reactivity can be influenced by the surrounding chemical environment, which is crucial for its practical applications.

Formula: C₈H₆BrN₃O₂

InChI: InChI=1S/C8H6BrN3O2/c1-14-8(13)7-6-4(9)2-10-3-5(6)11-12-7/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=HUIFPZAYDBOEJW-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=2C(NN1)=CN=CC2Br

Synonyms:

• Methyl 4-bromo-1H-pyrazolo[3,4-c]pyridine-3-carboxylate
• 1H-Pyrazolo[3,4-c]pyridine-3-carboxylic acid, 4-bromo-, methyl ester