CAS 1363381-50-3

7-Bromopyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Description:

7-Bromopyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both bromine and carboxylic acid functional groups. This compound typically exhibits a solid-state form and is soluble in polar organic solvents, reflecting its polar nature due to the carboxylic acid group. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. Its structure allows for potential interactions with biological targets, which may lead to applications in drug development. The compound's molecular framework contributes to its potential as a scaffold for designing novel pharmaceuticals, particularly in the context of targeting specific enzymes or receptors. Additionally, its stability under standard laboratory conditions makes it suitable for various chemical reactions, including substitution and coupling reactions. Overall, 7-Bromopyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a versatile compound with significant implications in both research and industrial applications.

Formula: C₇H₄BrN₃O₂

InChI: InChI=1S/C7H4BrN3O2/c8-5-1-2-9-6-4(7(12)13)3-10-11(5)6/h1-3H,(H,12,13)

InChI key: InChIKey=VHIXWFNFHMASCM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(N=C1)C(Br)=CC=N2

Synonyms:

• 7-Bromopyrazolo[1,5-a]pyrimidine-3-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 7-bromo-