
CAS 1363381-54-7
:trans-3-(Methylsulfonyl)cyclobutanamine
Description:
Trans-3-(Methylsulfonyl)cyclobutanamine is a chemical compound characterized by its unique cyclobutane ring structure, which is a four-membered carbon ring. The presence of a methylsulfonyl group (-SO2CH3) at the 3-position of the cyclobutane contributes to its polar nature and can influence its reactivity and solubility in various solvents. The amine functional group (-NH2) indicates that the compound can participate in hydrogen bonding, which may affect its physical properties such as boiling point and melting point. This compound may exhibit interesting biological activity due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, the trans configuration suggests that the substituents on the cyclobutane are oriented in a specific spatial arrangement, which can impact the compound's stereochemistry and interactions with biological targets. Overall, trans-3-(Methylsulfonyl)cyclobutanamine presents a unique combination of structural characteristics that may be explored for various applications in chemical and pharmaceutical research.
Formula:C5H11NO2S
InChI:InChI=1/C5H11NO2S/c1-9(7,8)5-2-4(6)3-5/h4-5H,2-3,6H2,1H3/t4-,5-
InChI key:InChIKey=NSBUFVLBFVLDPH-URHBZAFANA-N
SMILES:S(C)(=O)(=O)[C@H]1C[C@H](N)C1
Synonyms:- trans-3-(Methylsulfonyl)cyclobutanamine
- Cyclobutanamine, 3-(methylsulfonyl)-, trans-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery