CAS 1363381-62-7
:Methyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate
Description:
Methyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a bromine atom and a carboxylate functional group. The presence of the bromine atom typically enhances the compound's reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and drug development. The methyl ester group contributes to its solubility in organic solvents and can be hydrolyzed to yield the corresponding carboxylic acid. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its unique structure allows for potential applications in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many brominated compounds, it is essential to consider safety and environmental implications during handling and disposal. Overall, Methyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate represents a valuable compound in the field of organic chemistry.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-14-9(13)5-2-12-7-4-11-3-6(10)8(5)7/h2-4,12H,1H3
InChI key:InChIKey=YKLCBYMREBOXCU-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(NC1)=CN=CC2Br
Synonyms:- 1H-Pyrrolo[2,3-c]pyridine-3-carboxylic acid, 4-bromo-, methyl ester
- Methyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.