CAS 1363381-74-1
:1-(Phenylmethyl)-1,6-diazaspiro[3.4]octane
Description:
1-(Phenylmethyl)-1,6-diazaspiro[3.4]octane is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring two nitrogen atoms integrated into the ring system. This compound typically exhibits properties associated with both amines and spiro compounds, potentially influencing its reactivity and interactions. The presence of the phenylmethyl group contributes to its hydrophobic characteristics, which may affect its solubility in various solvents. Additionally, the diazaspiro structure can impart interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's molecular geometry and electronic configuration may lead to specific stereochemical properties, influencing its biological activity. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other intermolecular interactions, which can be crucial for its behavior in biological systems. Overall, 1-(Phenylmethyl)-1,6-diazaspiro[3.4]octane represents a complex and intriguing structure with potential applications in drug development and materials science.
Formula:C13H18N2
InChI:InChI=1S/C13H18N2/c1-2-4-12(5-3-1)10-15-9-7-13(15)6-8-14-11-13/h1-5,14H,6-11H2
InChI key:InChIKey=HVFOGWYVURWQFX-UHFFFAOYSA-N
SMILES:C(N1C2(CC1)CCNC2)C3=CC=CC=C3
Synonyms:- 1-(Phenylmethyl)-1,6-diazaspiro[3.4]octane
- 1,6-Diazaspiro[3.4]octane, 1-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
