
CAS 1363381-88-7
:2-Chloro-3-(dimethoxymethyl)pyrazine
Description:
2-Chloro-3-(dimethoxymethyl)pyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The compound features a chlorine substituent at the 2-position and a dimethoxymethyl group at the 3-position of the pyrazine ring. This structure contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the chlorine atom can enhance the compound's electrophilic nature, while the dimethoxymethyl group may influence its steric and electronic properties. Typically, compounds like this may be of interest in various fields, including pharmaceuticals, agrochemicals, and materials science, due to their potential biological activity and utility in synthesis. Additionally, the compound's specific interactions with biological systems or its role in chemical reactions would depend on its functional groups and overall molecular structure. Safety and handling considerations should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C7H9ClN2O2
InChI:InChI=1S/C7H9ClN2O2/c1-11-7(12-2)5-6(8)10-4-3-9-5/h3-4,7H,1-2H3
InChI key:InChIKey=XUZGBJHQJFVURP-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1C(Cl)=NC=CN1
Synonyms:- Pyrazine, 2-chloro-3-(dimethoxymethyl)-
- 2-Chloro-3-(dimethoxymethyl)pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.