CymitQuimica logo

CAS 1363381-91-2

:

Phenylmethyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate

Description:
Phenylmethyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate, identified by its CAS number 1363381-91-2, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom within a bicyclic framework. This compound features a phenylmethyl group, contributing to its aromatic properties, and a carboxylate functional group, which may influence its reactivity and solubility in various solvents. The presence of the 6-oxo group indicates a ketone functionality, which can participate in various chemical reactions, such as nucleophilic additions. The azaspiro structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to mimic complex biological structures. Additionally, the compound's stereochemistry and spatial arrangement may play a significant role in its biological activity and interactions with biological targets. Overall, this compound's distinctive features make it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C14H15NO3
InChI:InChI=1S/C14H15NO3/c16-12-6-14(7-12)9-15(10-14)13(17)18-8-11-4-2-1-3-5-11/h1-5H,6-10H2
InChI key:InChIKey=VKPRLSJKUKAFBP-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC3(C2)CC(=O)C3
Synonyms:
  • Benzyl 2-oxo-6-azaspiro[3.3]heptane-6-carboxylate
  • Phenylmethyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate
  • 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-oxo-, phenylmethyl ester
Found 4 products.