CAS 1363381-94-5

2-Methyl-2H-indazole-6-sulfonyl chloride

Description:

2-Methyl-2H-indazole-6-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a methyl group attached to the indazole ring, contributing to its unique structural properties. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in various nucleophilic substitution reactions. It is typically used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, where it can react with amines, alcohols, and other nucleophiles to form sulfonamides or sulfonate esters. The compound is likely to be a solid at room temperature and may require careful handling due to its potential reactivity and the release of hydrochloric acid upon hydrolysis. Safety precautions should be observed when working with this substance, as sulfonyl chlorides can be corrosive and harmful. Overall, 2-Methyl-2H-indazole-6-sulfonyl chloride is a valuable building block in synthetic organic chemistry.

Formula: C₈H₇ClN₂O₂S

InChI: InChI=1S/C8H7ClN2O2S/c1-11-5-6-2-3-7(14(9,12)13)4-8(6)10-11/h2-5H,1H3

InChI key: InChIKey=KAHDLORSPRSHEI-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CC=2C(C=C1)=CN(C)N2

Synonyms:

• 2H-Indazole-6-sulfonyl chloride, 2-methyl-
• 2-Methyl-2H-indazole-6-sulfonyl chloride