CAS 1363381-97-8

[(5-Chloro-3-thienyl)methyl]hydrazine

Description:

[(5-Chloro-3-thienyl)methyl]hydrazine is an organic compound characterized by the presence of a thienyl group, which is a five-membered aromatic ring containing sulfur, and a hydrazine functional group. The compound features a chlorine atom substituted at the 5-position of the thienyl ring, contributing to its reactivity and potential biological activity. The hydrazine moiety is known for its ability to form various derivatives and can participate in a range of chemical reactions, including oxidation and condensation. This compound may exhibit properties such as moderate solubility in organic solvents and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests that it could interact with biological targets, making it of interest for research in drug discovery. However, safety and handling precautions are essential, as hydrazines are generally considered to be toxic and potentially carcinogenic. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₅H₇ClN₂S

InChI: InChI=1S/C5H7ClN2S/c6-5-1-4(2-8-7)3-9-5/h1,3,8H,2,7H2

InChI key: InChIKey=JXZZBHOKSXPDJE-UHFFFAOYSA-N

SMILES: C(NN)C=1C=C(Cl)SC1

Synonyms:

• [(5-Chloro-3-thienyl)methyl]hydrazine
• Hydrazine, [(5-chloro-3-thienyl)methyl]-