CAS 1363381-99-0: Ethyl 4-bromopyrazolo[1,5-a]pyridine-2-carboxylate

Description:Ethyl 4-bromopyrazolo[1,5-a]pyridine-2-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazolo-pyridine framework. This compound features a bromine atom at the 4-position of the pyrazole ring and an ethyl ester functional group at the carboxylate position. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may possess biological activity, which could be of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, making it a subject of research in pharmacology. As with many organic compounds, handling should be done with care, considering safety protocols due to potential toxicity or reactivity.

Formula:C₁₀H₉BrN₂O₂

InChI:InChI=1S/C10H9BrN2O2/c1-2-15-10(14)8-6-9-7(11)4-3-5-13(9)12-8/h3-6H,2H2,1H3

InChI key:InChIKey=PJTPSVFSKTXWSU-UHFFFAOYSA-N

SMILES:O=C(OCC)C1=NN2C=CC=C(Br)C2=C1

Synonyms:
Ethyl 4-bromopyrazolo[1,5-a]pyridine-2-carboxylate
Pyrazolo[1,5-a]pyridine-2-carboxylic acid, 4-bromo-, ethyl ester

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Pyrazolo[1,5-a]pyridine-2-carboxylic acid, 4-bromo-, ethyl ester REF: IN-DA0011P4CAS: 1363381-99-0	97%	To inquire	Fri 21 Mar 25
Ethyl 4-bromopyrazolo[1,5-a]pyridine-2-carboxylate REF: 10-F221030CAS: 1363381-99-0	95.0%	To inquire	Mon 31 Mar 25
Ethyl 4-bromopyrazolo[1,5-a]pyridine-2-carboxylate REF: 3D-NEC38199CAS: 1363381-99-0	Min. 95%	- - -	Discontinued product